Products 146308-17-0
CAS 146308-17-0 is the registry number for N-(3,5-dimethoxyphenyl)-4-methylbenzenesulfonamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g.
N-(3,5-dimethoxyphenyl)-4-methylbenzenesulfonamide (CAS 146308-17-0) is a chemical compound with the molecular formula C15H17NO4S and a molecular weight of 307.4 g/mol. IUPAC name: N-(3,5-dimethoxyphenyl)-4-methylbenzenesulfonamide. InChIKey: AQHQRGBYUYCWLS-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4S |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | N-(3,5-dimethoxyphenyl)-4-methylbenzenesulfonamide |
| InChIKey | AQHQRGBYUYCWLS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=CC(=C2)OC)OC |
Computed by PubChem (NCBI)