cas: 22364-28-9 — see every product listed under this CAS number, including other names
N-(2-Bromo-4,5-dimethylphenyl)acetamide 97% (CAS 22364-28-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A529687-100mg |
| cas | 22364-28-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 464.94 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1332.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A529687 |
N-(2-bromo-4,5-dimethylphenyl)acetamide (CAS 22364-28-9) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: N-(2-bromo-4,5-dimethylphenyl)acetamide. InChIKey: SUNBHBXAMLHMAE-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | N-(2-bromo-4,5-dimethylphenyl)acetamide |
| InChIKey | SUNBHBXAMLHMAE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)Br)NC(=O)C |
Computed by PubChem (NCBI)