cas: 22364-28-9 — see every product listed under this CAS number, including other names
N-(2-Bromo-4,5-dimethylphenyl)acetamide (CAS 22364-28-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632657-1G |
| cas | 22364-28-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3340.51 Pln | |
| Fluorochem | 5g | 9869.46 Pln |
| delivery time | 3-4 weeks |
|---|
N-(2-bromo-4,5-dimethylphenyl)acetamide (CAS 22364-28-9) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: N-(2-bromo-4,5-dimethylphenyl)acetamide. InChIKey: SUNBHBXAMLHMAE-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | N-(2-bromo-4,5-dimethylphenyl)acetamide |
| InChIKey | SUNBHBXAMLHMAE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)Br)NC(=O)C |
Computed by PubChem (NCBI)