cas: 31592-84-4 — see every product listed under this CAS number, including other names
N-(3,5-dichlorophenyl)acetamide, 95%, 95% (CAS 31592-84-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D1AH-1g |
| cas | 31592-84-4 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2013.20 Pln | |
| Chemat | 5g | 8834.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(3,5-dichlorophenyl)acetamide (CAS 31592-84-4) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: N-(3,5-dichlorophenyl)acetamide. InChIKey: BJWFSDFXPISTBZ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | N-(3,5-dichlorophenyl)acetamide |
| InChIKey | BJWFSDFXPISTBZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)