cas: 746608-45-7 — see every product listed under this CAS number, including other names
N-(3-Bromo-4-methylphenyl)-2-chloroacetamide 95% (CAS 746608-45-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1010903-100mg |
| cas | 746608-45-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 364.81 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 921.06 Pln | |
| Ambeed | 5g | 3452.00 Pln | |
| Ambeed | 10g | 6622.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1010903 |
N-(3-bromo-4-methylphenyl)-2-chloroacetamide (CAS 746608-45-7) is a chemical compound with the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. IUPAC name: N-(3-bromo-4-methylphenyl)-2-chloroacetamide. InChIKey: QRGBHDFCJNDFIY-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | N-(3-bromo-4-methylphenyl)-2-chloroacetamide |
| InChIKey | QRGBHDFCJNDFIY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)CCl)Br |
Computed by PubChem (NCBI)