cas: 2415-87-4 — see every product listed under this CAS number, including other names
N-(3-Chlorophenyl)-3-oxobutanamide, 96%, 96% (CAS 2415-87-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C4WB-50mg |
| cas | 2415-87-4 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 184.40 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 1019.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
N-(3-chlorophenyl)-3-oxobutanamide (CAS 2415-87-4) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: N-(3-chlorophenyl)-3-oxobutanamide. InChIKey: MTPKMGABYQNMMG-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | N-(3-chlorophenyl)-3-oxobutanamide |
| InChIKey | MTPKMGABYQNMMG-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)