cas: 541539-64-4 — see every product listed under this CAS number, including other names
N-(4-Bromo-3,5-difluorophenyl)acetamide (CAS 541539-64-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211996-5G |
| cas | 541539-64-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 591.48 Pln | |
| Fluorochem | 10g | 945.52 Pln |
| delivery time | 3-4 weeks |
|---|
N-(4-bromo-3,5-difluorophenyl)acetamide (CAS 541539-64-4) is a chemical compound with the molecular formula C8H6BrF2NO and a molecular weight of 250.04 g/mol. IUPAC name: N-(4-bromo-3,5-difluorophenyl)acetamide. InChIKey: BMAYBWUHRDSJOJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO |
|---|---|
| Molecular weight | 250.04 g/mol |
| IUPAC name | N-(4-bromo-3,5-difluorophenyl)acetamide |
| InChIKey | BMAYBWUHRDSJOJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C(=C1)F)Br)F |
Computed by PubChem (NCBI)