Products 1065100-92-6
CAS 1065100-92-6 is the registry number for N-(4-Bromo-2,5-difluorophenyl)acetamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
N-(4-bromo-2,5-difluorophenyl)acetamide (CAS 1065100-92-6) is a chemical compound with the molecular formula C8H6BrF2NO and a molecular weight of 250.04 g/mol. IUPAC name: N-(4-bromo-2,5-difluorophenyl)acetamide. InChIKey: DNRBTECPJLQZPJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO |
|---|---|
| Molecular weight | 250.04 g/mol |
| IUPAC name | N-(4-bromo-2,5-difluorophenyl)acetamide |
| InChIKey | DNRBTECPJLQZPJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1F)Br)F |
Computed by PubChem (NCBI)