Products 1695625-02-5

CAS 1695625-02-5 is the registry number for N-(2-bromophenyl)-2,2-difluoroacetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

N-(2-bromophenyl)-2,2-difluoroacetamide (CAS 1695625-02-5) is a chemical compound with the molecular formula C8H6BrF2NO and a molecular weight of 250.04 g/mol. IUPAC name: N-(2-bromophenyl)-2,2-difluoroacetamide. InChIKey: LGHPLQRVWKCGPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrF2NO
Molecular weight250.04 g/mol
IUPAC nameN-(2-bromophenyl)-2,2-difluoroacetamide
InChIKeyLGHPLQRVWKCGPQ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)NC(=O)C(F)F)Br

Computed by PubChem (NCBI)