CAS 1695625-02-5 is the registry number for N-(2-bromophenyl)-2,2-difluoroacetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-(2-bromophenyl)-2,2-difluoroacetamide (CAS 1695625-02-5) is a chemical compound with the molecular formula C8H6BrF2NO and a molecular weight of 250.04 g/mol. IUPAC name: N-(2-bromophenyl)-2,2-difluoroacetamide. InChIKey: LGHPLQRVWKCGPQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO |
|---|---|
| Molecular weight | 250.04 g/mol |
| IUPAC name | N-(2-bromophenyl)-2,2-difluoroacetamide |
| InChIKey | LGHPLQRVWKCGPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)C(F)F)Br |
Computed by PubChem (NCBI)