CAS 1864604-03-4 is the registry number for 5-Bromo-2,4-difluoro-n-methylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-bromo-2,4-difluoro-N-methylbenzamide (CAS 1864604-03-4) is a chemical compound with the molecular formula C8H6BrF2NO and a molecular weight of 250.04 g/mol. IUPAC name: 5-bromo-2,4-difluoro-N-methylbenzamide. InChIKey: CEAINNBZGGZQTP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO |
|---|---|
| Molecular weight | 250.04 g/mol |
| IUPAC name | 5-bromo-2,4-difluoro-N-methylbenzamide |
| InChIKey | CEAINNBZGGZQTP-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=C(C=C1F)F)Br |
Computed by PubChem (NCBI)