Products 1365889-33-3
CAS 1365889-33-3 appears in our catalog under these names: O-Methyl-(e)-5-bromo-2,3-difluorobenzaldehyde oxime, 95%, O-Methyl-(E)-5-bromo-2,3-difluorobenzaldehyde oxime, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(E)-1-(5-bromo-2,3-difluorophenyl)-N-methoxymethanimine (CAS 1365889-33-3) is a chemical compound with the molecular formula C8H6BrF2NO and a molecular weight of 250.04 g/mol. IUPAC name: (E)-1-(5-bromo-2,3-difluorophenyl)-N-methoxymethanimine. InChIKey: MNWWSXUNSCUBHU-UUILKARUSA-N.
| Molecular formula | C8H6BrF2NO |
|---|---|
| Molecular weight | 250.04 g/mol |
| IUPAC name | (E)-1-(5-bromo-2,3-difluorophenyl)-N-methoxymethanimine |
| InChIKey | MNWWSXUNSCUBHU-UUILKARUSA-N |
| SMILES | CO/N=C/C1=C(C(=CC(=C1)Br)F)F |
Computed by PubChem (NCBI)