CAS 405937-75-9 appears in our catalog under these names: 2-Bromo-n-(3,5-difluorophenyl)acetamide, 95%, 2-Bromo-N-(3,5-difluorophenyl)acetamide 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-bromo-N-(3,5-difluorophenyl)acetamide (CAS 405937-75-9) is a chemical compound with the molecular formula C8H6BrF2NO and a molecular weight of 250.04 g/mol. IUPAC name: 2-bromo-N-(3,5-difluorophenyl)acetamide. InChIKey: YMXZOQRAUCACRG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO |
|---|---|
| Molecular weight | 250.04 g/mol |
| IUPAC name | 2-bromo-N-(3,5-difluorophenyl)acetamide |
| InChIKey | YMXZOQRAUCACRG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)NC(=O)CBr |
Computed by PubChem (NCBI)