cas: 5443-33-4 — see every product listed under this CAS number, including other names
N-(5-Chloro-2-nitrophenyl)acetamide, 95%, 95% (CAS 5443-33-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SDN-1g |
| cas | 5443-33-4 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 539.60 Pln | |
| Chemat | 5g | 1638.80 Pln | |
| Chemat | 25g | 7149.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(5-chloro-2-nitrophenyl)acetamide (CAS 5443-33-4) is a chemical compound with the molecular formula C8H7ClN2O3 and a molecular weight of 214.60 g/mol. IUPAC name: N-(5-chloro-2-nitrophenyl)acetamide. InChIKey: YWANGSCDWBUSBK-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O3 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | N-(5-chloro-2-nitrophenyl)acetamide |
| InChIKey | YWANGSCDWBUSBK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)