CAS 1820703-51-2 appears in our catalog under these names: 5-Acetamido-3-chloropyridine-2-carboxylic acid, 98%, 5-Acetamido-3-chloropicolinic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.
5-acetamido-3-chloropyridine-2-carboxylic acid (CAS 1820703-51-2) is a chemical compound with the molecular formula C8H7ClN2O3 and a molecular weight of 214.60 g/mol. IUPAC name: 5-acetamido-3-chloropyridine-2-carboxylic acid. InChIKey: SCDGQHNXRXKORJ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O3 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 5-acetamido-3-chloropyridine-2-carboxylic acid |
| InChIKey | SCDGQHNXRXKORJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(N=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)