cas: 157701-33-2 — see every product listed under this CAS number, including other names
N-(6-Bromo-2,3-dihydro-1H-inden-5-yl)acetamide 97% (CAS 157701-33-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A451347-1g |
| cas | 157701-33-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 693.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A451347 |
N-(6-bromo-2,3-dihydro-1H-inden-5-yl)acetamide (CAS 157701-33-2) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: N-(6-bromo-2,3-dihydro-1H-inden-5-yl)acetamide. InChIKey: BSZWXNUSLPNWEZ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | N-(6-bromo-2,3-dihydro-1H-inden-5-yl)acetamide |
| InChIKey | BSZWXNUSLPNWEZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C2CCCC2=C1)Br |
Computed by PubChem (NCBI)