cas: 1820711-54-3 — see every product listed under this CAS number, including other names
N-(naphthalen-1-yl)-2,3-dihydrobenzo[b][1,4]dioxin-6-amine, ≥97%, ≥97% (CAS 1820711-54-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I217-250mg |
| cas | 1820711-54-3 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 818.00 Pln | |
| Chemat | 1g | 2181.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
N-naphthalen-1-yl-2,3-dihydro-1,4-benzodioxin-6-amine (CAS 1820711-54-3) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: N-naphthalen-1-yl-2,3-dihydro-1,4-benzodioxin-6-amine. InChIKey: WFXOBCJXPSQWNH-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | N-naphthalen-1-yl-2,3-dihydro-1,4-benzodioxin-6-amine |
| InChIKey | WFXOBCJXPSQWNH-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)NC3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)