cas: 471915-89-6 — see every product listed under this CAS number, including other names
N-[2-(3,4-DIHYDROXYPHENYL)ETHYL]-2-METHYL-2-PROPENAMIDE, 98% (CAS 471915-89-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F801859-100MG |
| cas | 471915-89-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 487.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-[2-(3,4-dihydroxyphenyl)ethyl]-2-methylprop-2-enamide (CAS 471915-89-6) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: N-[2-(3,4-dihydroxyphenyl)ethyl]-2-methylprop-2-enamide. InChIKey: NQIMONOHVBBZKE-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-methylprop-2-enamide |
| InChIKey | NQIMONOHVBBZKE-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)NCCC1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)