cas: 471915-89-6 — see every product listed under this CAS number, including other names
N-[2-(3,4-Dihydroxyphenyl)ethyl]-2-methyl-2-propenamide, 98%, 98% (CAS 471915-89-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114A1J-250mg |
| cas | 471915-89-6 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 990.80 Pln | |
| Chemat | 10g | 1922.00 Pln | |
| Chemat | 25g | 3923.60 Pln | |
| Chemat | 50g | 4850.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[2-(3,4-dihydroxyphenyl)ethyl]-2-methylprop-2-enamide (CAS 471915-89-6) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: N-[2-(3,4-dihydroxyphenyl)ethyl]-2-methylprop-2-enamide. InChIKey: NQIMONOHVBBZKE-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-methylprop-2-enamide |
| InChIKey | NQIMONOHVBBZKE-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)NCCC1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)