N-Acetyl-L-phenylalanine, 99%, 99%
cas: 2018-61-3 — see every product listed under this CAS number, including other names
N-Acetyl-L-phenylalanine, 99%, 99% (CAS 2018-61-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg, 5kg, 10kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1138UP-5g |
| cas | 2018-61-3 |
| size | 5g |
| availability | 70000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 98.00 Pln | |
| Chemat | 500g | 235.20 Pln | |
| Chemat | 1kg | 352.40 Pln | |
| Chemat | 5kg | 2068.80 Pln | |
| Chemat | 10kg | price on request |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
N-acetyl-L-phenylalanine is the N-acetyl derivative of L-phenylalanine. It has a role as a metabolite. It is a N-acetyl-L-amino acid, a N-acetylphenylalanine and a N-acyl-L-phenylalanine. It is a conjugate acid of a N-acetyl-L-phenylalaninate. It is an enantiomer of a N-acetyl-D-phenylalanine.
Source: ChEBI
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | (2S)-2-acetamido-3-phenylpropanoic acid |
| InChIKey | CBQJSKKFNMDLON-JTQLQIEISA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)