cas: 132201-33-3 — see every product listed under this CAS number, including other names
N-Benzoyl-(2R,3S)-3-phenylisoserine, 99.48% (CAS 132201-33-3) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 10 mg, 5 mg, 100 mg, 50 mg, 25 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-N2380-10mM/1mL |
| cas | 132201-33-3 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 384.71 Pln | |
| MedChemExpress | 10 mg | 361.49 Pln | |
| MedChemExpress | 5 mg | 273.25 Pln | |
| MedChemExpress | 100 mg | 765.52 Pln | |
| MedChemExpress | 50 mg | 621.55 Pln | |
| MedChemExpress | 25 mg | 505.45 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.48% |
(2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoic acid (CAS 132201-33-3) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoic acid. InChIKey: HYJVYOWKYPNSTK-UONOGXRCSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoic acid |
| InChIKey | HYJVYOWKYPNSTK-UONOGXRCSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]([C@H](C(=O)O)O)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)