CAS 54323-80-7 is the registry number for (2S,3R)-3-Benzamido-2-hydroxy-3-phenylpropanoic Acid. Offered by: TRC. Available pack sizes: 2,5g.
(2S,3R)-3-benzamido-2-hydroxy-3-phenylpropanoic acid (CAS 54323-80-7) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: (2S,3R)-3-benzamido-2-hydroxy-3-phenylpropanoic acid. InChIKey: HYJVYOWKYPNSTK-KGLIPLIRSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | (2S,3R)-3-benzamido-2-hydroxy-3-phenylpropanoic acid |
| InChIKey | HYJVYOWKYPNSTK-KGLIPLIRSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]([C@@H](C(=O)O)O)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)