cas: 913642-78-1 — see every product listed under this CAS number, including other names
N-Boc-2-(2-Hydroxyethyl)morpholine, 97% (CAS 913642-78-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221734-100MG |
| cas | 913642-78-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 581.06 Pln | |
| Fluorochem | 250mg | 924.69 Pln | |
| Fluorochem | 1g | 2132.60 Pln | |
| Fluorochem | 5g | 7089.19 Pln | |
| Fluorochem | 10g | 14123.17 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-(2-hydroxyethyl)morpholine-4-carboxylate (CAS 913642-78-1) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: tert-butyl 2-(2-hydroxyethyl)morpholine-4-carboxylate. InChIKey: VUDVZUAUPOAVLM-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | tert-butyl 2-(2-hydroxyethyl)morpholine-4-carboxylate |
| InChIKey | VUDVZUAUPOAVLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC(C1)CCO |
Computed by PubChem (NCBI)