cas: 913642-78-1 — see every product listed under this CAS number, including other names
tert-Butyl 2-(2-hydroxyethyl),morpholine-4-carboxylate, 98%, 98% (CAS 913642-78-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117BO4-100mg |
| cas | 913642-78-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 515.60 Pln | |
| Chemat | 1g | 1082.00 Pln | |
| Chemat | 5g | 3981.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-(2-hydroxyethyl)morpholine-4-carboxylate (CAS 913642-78-1) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: tert-butyl 2-(2-hydroxyethyl)morpholine-4-carboxylate. InChIKey: VUDVZUAUPOAVLM-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | tert-butyl 2-(2-hydroxyethyl)morpholine-4-carboxylate |
| InChIKey | VUDVZUAUPOAVLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC(C1)CCO |
Computed by PubChem (NCBI)