CAS 104839-00-1 appears in our catalog under these names: (S)–2–((tert–Butoxycarbonyl)amino)–3–ethoxypropanoic acid, N-Boc-O-ethyl-L-serine, 97% , (S)-N-Boc-2-amino-3-ethoxy-propionic acid, (S)-2-((tert-Butoxycarbonyl)amino)-3-ethoxypropanoic acid, 95%, 95%, Boc-Ser(OEt)-OH, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 2,5g.
(2S)-3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 104839-00-1) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: (2S)-3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KNBDVSSESAKBJM-ZETCQYMHSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (2S)-3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KNBDVSSESAKBJM-ZETCQYMHSA-N |
| SMILES | CCOC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)