Products 856417-66-8

CAS 856417-66-8 is the registry number for 2-{((tert-Butoxy)carbonyl)amino}-3-ethoxypropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 856417-66-8) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: 3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KNBDVSSESAKBJM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H19NO5
Molecular weight233.26 g/mol
IUPAC name3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
InChIKeyKNBDVSSESAKBJM-UHFFFAOYSA-N
SMILESCCOCC(C(=O)O)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)