cas: 189321-66-2 — see every product listed under this CAS number, including other names
N-Boc-morpholine-2-carboxylic acid 97% (CAS 189321-66-2) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A102703-1000g |
| cas | 189321-66-2 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 4881.56 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 159.00 Pln | |
| Ambeed | 10g | 181.25 Pln | |
| Ambeed | 25g | 270.25 Pln | |
| Ambeed | 100g | 670.75 Pln | |
| Ambeed | 500g | 3073.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A102703 |
4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid (CAS 189321-66-2) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid. InChIKey: LGWMTRPJZFEWCX-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid |
| InChIKey | LGWMTRPJZFEWCX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC(C1)C(=O)O |
Computed by PubChem (NCBI)