CAS 189321-66-2 appears in our catalog under these names: N-Boc-morpholine-2-carboxylic acid 97%, 4-Boc-2-morpholinecarboxylic acid, 97%, 97%, N-Boc-Morpholine-2-carboxylic acid, 95%, Boc-Cop-OH. Offered by: Ambeed, Chemat, Fluorochem, Iris Biotech. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g.
4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid (CAS 189321-66-2) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid. InChIKey: LGWMTRPJZFEWCX-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid |
| InChIKey | LGWMTRPJZFEWCX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC(C1)C(=O)O |
Computed by PubChem (NCBI)