cas: 28697-07-6 — see every product listed under this CAS number, including other names
N-Cbz-2-Piperidinecarboxylic acid, 98%, 98% (CAS 28697-07-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113W67-5g |
| cas | 28697-07-6 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 88.40 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 443.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-phenylmethoxycarbonylpiperidine-2-carboxylic acid (CAS 28697-07-6) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: 1-phenylmethoxycarbonylpiperidine-2-carboxylic acid. InChIKey: ZSAIHAKADPJIGN-UHFFFAOYSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 1-phenylmethoxycarbonylpiperidine-2-carboxylic acid |
| InChIKey | ZSAIHAKADPJIGN-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)