CAS 28697-11-2 appears in our catalog under these names: (S)–(–)–1–Cbz–2–piperidinecarboxylic acid, Cbz-HoPro-OH 98%, (S)-1-N-Cbz-Pipecolinic acid, 98%, 98%, (S)-1-N-Cbz-Pipecolinic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 100g.
(2S)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid (CAS 28697-11-2) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: (2S)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid. InChIKey: ZSAIHAKADPJIGN-LBPRGKRZSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | (2S)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid |
| InChIKey | ZSAIHAKADPJIGN-LBPRGKRZSA-N |
| SMILES | C1CCN([C@@H](C1)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)