N-Cbz-piperidine-2-carboxylic acid, 98%
cas: 71170-88-2 — see every product listed under this CAS number, including other names
N-Cbz-piperidine-2-carboxylic acid, 98% (CAS 71170-88-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A317760-5g |
| cas | 71170-88-2 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 153.44 Pln | |
| Ambeed | 25g | 320.31 Pln | |
| Ambeed | 100g | 887.69 Pln | |
| Ambeed | 500g | 2784.50 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 25g | 308.80 Pln | |
| BLDpharm | 100g | 869.72 Pln | |
| BLDpharm | 500g | 2730.17 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 25g | 261.20 Pln | |
| Chemat | 100g | 640.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-phenylmethoxycarbonylpiperidine-2-carboxylic acid (CAS 71170-88-2) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: 1-phenylmethoxycarbonylpiperidine-2-carboxylic acid. InChIKey: ZSAIHAKADPJIGN-UHFFFAOYSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 1-phenylmethoxycarbonylpiperidine-2-carboxylic acid |
| InChIKey | ZSAIHAKADPJIGN-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
1-Carbobenzoxy-2-piperidinecarboxylic Acid, N-Cbz-2-Piperidinecarboxylic acid, N-CBZ-piperidine-2-carboxylic acid, 1-Cbz-Piperidine-2-Carboxylic Acid, 1-phenylmethoxycarbonylpiperidine-2-carboxylic Acid, 1-((benzyloxy)carbonyl)piperidine-2-carboxylic acid, 1-[(benzyloxy)carbonyl]piperidine-2-carboxylic acid, N-Carbobenzyloxy-2-piperidinecarboxylic acid, 1-N-Cbz-piperidine-2-carboxylic acid, 1-(benzyloxycarbonyl)piperidine-2-carboxylic acid