N-Methyl-3-(2-methylthiazol-4-yl)aniline, 95%
cas: 1339729-30-4 — see every product listed under this CAS number, including other names
N-Methyl-3-(2-methylthiazol-4-yl)aniline, 95% (CAS 1339729-30-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1047795-100mg |
| cas | 1339729-30-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1405.00 Pln | |
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 654.80 Pln | |
| Chemat | 1g | 1667.60 Pln | |
| Fluorochem | 1g | 3106.22 Pln | |
| Fluorochem | 100mg | 747.67 Pln | |
| Fluorochem | 250mg | 1211.05 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 553.16 Pln | |
| BLDpharm | 1g | 1375.10 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
N-methyl-3-(2-methyl-1,3-thiazol-4-yl)aniline (CAS 1339729-30-4) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: N-methyl-3-(2-methyl-1,3-thiazol-4-yl)aniline. InChIKey: FYJKADIDHIYTMQ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | N-methyl-3-(2-methyl-1,3-thiazol-4-yl)aniline |
| InChIKey | FYJKADIDHIYTMQ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=CC=C2)NC |
Computed by PubChem (NCBI)