CAS 472996-14-8 appears in our catalog under these names: 4-Benzyl-5-methyl-1h-imidazole-2-thiol, 95%, 4-Benzyl-5-methyl-1H-imidazole-2-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 5000mg.
4-benzyl-5-methyl-1,3-dihydroimidazole-2-thione (CAS 472996-14-8) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 4-benzyl-5-methyl-1,3-dihydroimidazole-2-thione. InChIKey: PUBLWZQCQIJQJH-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 4-benzyl-5-methyl-1,3-dihydroimidazole-2-thione |
| InChIKey | PUBLWZQCQIJQJH-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=S)N1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)