N1-Hexyl-N4-phenylbenzene-1,4-diamine, 95%
cas: 76154-77-3 — see every product listed under this CAS number, including other names
N1-Hexyl-N4-phenylbenzene-1,4-diamine, 95% (CAS 76154-77-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2637589-100mg |
| cas | 76154-77-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 420.44 Pln | |
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 1677.56 Pln | |
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 573.20 Pln | |
| Chemat | 1g | 1437.20 Pln | |
| BLDpharm | 100mg | 419.88 Pln | |
| BLDpharm | 250mg | 653.13 Pln | |
| BLDpharm | 1g | 1652.78 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-N-hexyl-4-N-phenylbenzene-1,4-diamine (CAS 76154-77-3) is a chemical compound with the molecular formula C18H24N2 and a molecular weight of 268.4 g/mol. IUPAC name: 1-N-hexyl-4-N-phenylbenzene-1,4-diamine. InChIKey: LISMVBJUACINFW-UHFFFAOYSA-N.
| Molecular formula | C18H24N2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | 1-N-hexyl-4-N-phenylbenzene-1,4-diamine |
| InChIKey | LISMVBJUACINFW-UHFFFAOYSA-N |
| SMILES | CCCCCCNC1=CC=C(C=C1)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)