CAS 2444430-62-8 appears in our catalog under these names: (1R,2R)-N1,N2-Dimethyl-1,2-di-p-tolylethane-1,2-diamine, 97%, (1R,2R)-N1,N2-dimethyl-1,2-di-p-tolylethane-1,2-diamine, ≥97%(HPLC),≥99%(ee), ≥97%(HPLC),≥99%(ee). Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25mg, 100mg, 500mg.
(1R,2R)-N,N'-dimethyl-1,2-bis(4-methylphenyl)ethane-1,2-diamine (CAS 2444430-62-8) is a chemical compound with the molecular formula C18H24N2 and a molecular weight of 268.4 g/mol. IUPAC name: (1R,2R)-N,N'-dimethyl-1,2-bis(4-methylphenyl)ethane-1,2-diamine. InChIKey: ZTEOTXZAFQRCTP-QZTJIDSGSA-N.
| Molecular formula | C18H24N2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | (1R,2R)-N,N'-dimethyl-1,2-bis(4-methylphenyl)ethane-1,2-diamine |
| InChIKey | ZTEOTXZAFQRCTP-QZTJIDSGSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H]([C@@H](C2=CC=C(C=C2)C)NC)NC |
Computed by PubChem (NCBI)