CAS 144186-34-5 is the registry number for (2R,5R)-1,6-Diphenylhexane-2,5-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5R)-1,6-diphenylhexane-2,5-diamine (CAS 144186-34-5) is a chemical compound with the molecular formula C18H24N2 and a molecular weight of 268.4 g/mol. IUPAC name: (2R,5R)-1,6-diphenylhexane-2,5-diamine. InChIKey: CTVQBUFULGSGGL-QZTJIDSGSA-N.
| Molecular formula | C18H24N2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | (2R,5R)-1,6-diphenylhexane-2,5-diamine |
| InChIKey | CTVQBUFULGSGGL-QZTJIDSGSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CC[C@H](CC2=CC=CC=C2)N)N |
Computed by PubChem (NCBI)