CAS 503112-15-0 is the registry number for (1R,2R)-1,2-Bis(3,5-dimethylphenyl)ethane-1,2-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R)-1,2-bis(3,5-dimethylphenyl)ethane-1,2-diamine (CAS 503112-15-0) is a chemical compound with the molecular formula C18H24N2 and a molecular weight of 268.4 g/mol. IUPAC name: (1R,2R)-1,2-bis(3,5-dimethylphenyl)ethane-1,2-diamine. InChIKey: POWCVEXEFGJWNW-QZTJIDSGSA-N.
| Molecular formula | C18H24N2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | (1R,2R)-1,2-bis(3,5-dimethylphenyl)ethane-1,2-diamine |
| InChIKey | POWCVEXEFGJWNW-QZTJIDSGSA-N |
| SMILES | CC1=CC(=CC(=C1)[C@H]([C@@H](C2=CC(=CC(=C2)C)C)N)N)C |
Computed by PubChem (NCBI)