CAS 37055-28-0 is the registry number for 2,4,6,2',4',6'-Hexamethyl-biphenyl-3,3'-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(3-amino-2,4,6-trimethylphenyl)-2,4,6-trimethylaniline (CAS 37055-28-0) is a chemical compound with the molecular formula C18H24N2 and a molecular weight of 268.4 g/mol. IUPAC name: 3-(3-amino-2,4,6-trimethylphenyl)-2,4,6-trimethylaniline. InChIKey: FDKSOTQXIQYHOW-UHFFFAOYSA-N.
| Molecular formula | C18H24N2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | 3-(3-amino-2,4,6-trimethylphenyl)-2,4,6-trimethylaniline |
| InChIKey | FDKSOTQXIQYHOW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C2=C(C(=C(C=C2C)C)N)C)C)N)C |
Computed by PubChem (NCBI)