Products 158391-59-4
CAS 158391-59-4 appears in our catalog under these names: (1S,2S)-1,2-Bis(3,5-dimethylphenyl)ethane-1,2-diamine, 97%, (1S,2S)–1,2–bis(3,5–dimethylphenyl)ethane–1,2–diamine, (1S,2S)-1,2-bis(3,5-dimethylphenyl)ethane-1,2-diamine, 97%HPLC，99% ee, 97%HPLC，99% ee. Offered by: Chemat Brand, GLPBio, Chemat. Available pack sizes: on request, 100mg, 1g, 500mg.
(1S,2S)-1,2-bis(3,5-dimethylphenyl)ethane-1,2-diamine (CAS 158391-59-4) is a chemical compound with the molecular formula C18H24N2 and a molecular weight of 268.4 g/mol. IUPAC name: (1S,2S)-1,2-bis(3,5-dimethylphenyl)ethane-1,2-diamine. InChIKey: POWCVEXEFGJWNW-ROUUACIJSA-N.
| Molecular formula | C18H24N2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | (1S,2S)-1,2-bis(3,5-dimethylphenyl)ethane-1,2-diamine |
| InChIKey | POWCVEXEFGJWNW-ROUUACIJSA-N |
| SMILES | CC1=CC(=CC(=C1)[C@@H]([C@H](C2=CC(=CC(=C2)C)C)N)N)C |
Computed by PubChem (NCBI)