CAS 327062-46-4 appears in our catalog under these names: 5-((4-bromophenyl)methyl)-1,3-thiazol-2-amine, 5-(4-Bromobenzyl)thiazol-2-amine, 98%, 98%, 5-(4-BROMOBENZYL)-1,3-THIAZOL-2-AMINE, ≥97%, NS19504/ 99.87% (existing batch purity), NS19504. Offered by: Biosynth, Chemat, Fluorochem, TargetMol, GLPBio. Available pack sizes: 250mg, 2,5g, 10mg, 25mg, 50mg, 100mg, 5mg, 500mg.
5-[(4-bromophenyl)methyl]-1,3-thiazol-2-amine (CAS 327062-46-4) is a chemical compound with the molecular formula C10H9BrN2S and a molecular weight of 269.16 g/mol. IUPAC name: 5-[(4-bromophenyl)methyl]-1,3-thiazol-2-amine. InChIKey: HGWLTZOMQZIUBW-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2S |
|---|---|
| Molecular weight | 269.16 g/mol |
| IUPAC name | 5-[(4-bromophenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | HGWLTZOMQZIUBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CN=C(S2)N)Br |
Computed by PubChem (NCBI)