CAS 94023-67-3 appears in our catalog under these names: NSC 65809/ 99.84% (existing batch purity), N-{[(2,3-dichlorophenyl)methylidene]amino}guanidine, (E/Z)-Raphin1. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg.
2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine (CAS 94023-67-3) is a chemical compound with the molecular formula C8H8Cl2N4 and a molecular weight of 231.08 g/mol. IUPAC name: 2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine. InChIKey: WLTSTDGGFCQWTK-YIXHJXPBSA-N.
| Molecular formula | C8H8Cl2N4 |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine |
| InChIKey | WLTSTDGGFCQWTK-YIXHJXPBSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)/C=N/N=C(N)N |
Computed by PubChem (NCBI)