CAS 6314-70-1 appears in our catalog under these names: NSC23005 free acid, NSC23005/ 99.71% (existing batch purity), NSC23005, NSC23005, 98%, 98%, INK4C-IN-2, 98.10%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 25mg, 50mg, 100mg, 0,5g.
4-(cyclohexylsulfamoyl)benzoic acid (CAS 6314-70-1) is a chemical compound with the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. IUPAC name: 4-(cyclohexylsulfamoyl)benzoic acid. InChIKey: XGOXPTXOQXHIDL-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | 4-(cyclohexylsulfamoyl)benzoic acid |
| InChIKey | XGOXPTXOQXHIDL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NS(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)