cas: 188106-83-4 — see every product listed under this CAS number, including other names
NU1085, 98% (CAS 188106-83-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A439554-10g |
| cas | 188106-83-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 13018.39 Pln | |
| AmBeed | 5g | 8025.22 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-hydroxyphenyl)-1H-benzimidazole-4-carboxamide (CAS 188106-83-4) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-1H-benzimidazole-4-carboxamide. InChIKey: KOUGHMOSYJCJLE-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-1H-benzimidazole-4-carboxamide |
| InChIKey | KOUGHMOSYJCJLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=N2)C3=CC=C(C=C3)O)C(=O)N |
Computed by PubChem (NCBI)