CAS 1082193-74-5 is the registry number for 3-P-Tolyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(4-methylphenyl)-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid (CAS 1082193-74-5) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 3-(4-methylphenyl)-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid. InChIKey: SBQXCEKGEAPNPT-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 3-(4-methylphenyl)-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid |
| InChIKey | SBQXCEKGEAPNPT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN=C3N2C=CC=C3C(=O)O |
Computed by PubChem (NCBI)