CAS 102791-47-9 appears in our catalog under these names: Nanterinone/ 99.11% (existing batch purity), Nanterinone. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
6-(2,4-dimethylimidazol-1-yl)-8-methyl-1H-quinolin-2-one (CAS 102791-47-9) is a chemical compound with the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. IUPAC name: 6-(2,4-dimethylimidazol-1-yl)-8-methyl-1H-quinolin-2-one. InChIKey: NMNXBEXPAHSXOK-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | 6-(2,4-dimethylimidazol-1-yl)-8-methyl-1H-quinolin-2-one |
| InChIKey | NMNXBEXPAHSXOK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=O)C=C2)N3C=C(N=C3C)C |
Computed by PubChem (NCBI)