CAS 2241-98-7 appears in our catalog under these names: 2-Naphthalenemethylamine hydrochloride, 98%, Naphthalen–2–ylmethanamine hydrochloride, Naphthalen-2-ylmethanamine hydrochloride, 97%, 97%, Naphthalene-2-methanamine hydrochloride, 90%, Naphthalen-2-ylmethanamine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Naphthalen-2-ylmethanamine;hydrochloride (CAS 2241-98-7) is a chemical compound with the molecular formula C11H12ClN and a molecular weight of 193.67 g/mol. IUPAC name: naphthalen-2-ylmethanamine;hydrochloride. InChIKey: CNWUJWGKBBBOKY-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | naphthalen-2-ylmethanamine;hydrochloride |
| InChIKey | CNWUJWGKBBBOKY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CN.Cl |
Computed by PubChem (NCBI)