CAS 57322-45-9 appears in our catalog under these names: Naphthalene–1,4–diyldimethanol, 1,4-Naphthalenedimethanol, 95%, 95%, Naphthalene-1,4-diyldimethanol, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
[4-(hydroxymethyl)naphthalen-1-yl]methanol (CAS 57322-45-9) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: [4-(hydroxymethyl)naphthalen-1-yl]methanol. InChIKey: JAKLGXVFNYYOSU-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | [4-(hydroxymethyl)naphthalen-1-yl]methanol |
| InChIKey | JAKLGXVFNYYOSU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=CC=C(C2=C1)CO)CO |
Computed by PubChem (NCBI)