CAS 2089-89-6 appears in our catalog under these names: Naphthalene–2,7–dicarboxylic acid, 2,7-Naphthalenedicarboxylicacid, 2,7-Naphthalenedicarboxylic acid, 98%, Naphthalene-2,7-dicarboxylic acid, 95%, 95%, Naphthalene-2,7-dicarboxylic acid, 97%. Offered by: GLPBio, Biosynth, Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg, 25g.
Naphthalene-2,7-dicarboxylic acid (CAS 2089-89-6) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. IUPAC name: naphthalene-2,7-dicarboxylic acid. InChIKey: WPUMVKJOWWJPRK-UHFFFAOYSA-N.
| Molecular formula | C12H8O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | naphthalene-2,7-dicarboxylic acid |
| InChIKey | WPUMVKJOWWJPRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)