cas: 22472-26-0 — see every product listed under this CAS number, including other names
Naphthalene-2,7-diyl diacetate 95+% (CAS 22472-26-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A317034-5g |
| cas | 22472-26-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 25g | 1672.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A317034 |
(7-acetyloxynaphthalen-2-yl) acetate (CAS 22472-26-0) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: (7-acetyloxynaphthalen-2-yl) acetate. InChIKey: VRMXWHJBWOVBEJ-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | (7-acetyloxynaphthalen-2-yl) acetate |
| InChIKey | VRMXWHJBWOVBEJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C=CC(=C2)OC(=O)C |
Computed by PubChem (NCBI)