cas: 38713-56-3 — see every product listed under this CAS number, including other names
Nonyl 4-hydroxybenzoate (CAS 38713-56-3) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 250g, 500g, 250mg, 1g, 5g, 25g. Offered by: Biosynth, Chemat, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | FN67828-50g |
| cas | 38713-56-3 |
| size | 50g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 50g | price on request | |
| Biosynth | 100g | price on request | |
| Biosynth | 250g | price on request | |
| Biosynth | 500g | price on request | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 242.00 Pln | |
| Chemat | 25g | 256.40 Pln | |
| Chemat | 100g | 784.40 Pln | |
| Chemat | 500g | 2683.20 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 372.80 Pln | |
| Fluorochem | 25g | 393.63 Pln | |
| Fluorochem | 100g | 1268.32 Pln | |
| Fluorochem | 500g | 4298.50 Pln |
| category | Research Chemicals |
|---|---|
| purity | No data |
| delivery time | 1-2 weeks |
Nonyl 4-hydroxybenzoate (CAS 38713-56-3) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: nonyl 4-hydroxybenzoate. InChIKey: MBNSKHJDYXPONL-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | nonyl 4-hydroxybenzoate |
| InChIKey | MBNSKHJDYXPONL-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)