Products 62435-37-4
CAS 62435-37-4 appears in our catalog under these names: Methyl 4–n–octyloxybenzoate, Methyl 4-n-octyloxybenzoate, 95%, Methyl 4-(octyloxy)benzoate, 98%, Methyl 4-n-octyloxybenzoate, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
Methyl 4-octoxybenzoate (CAS 62435-37-4) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: methyl 4-octoxybenzoate. InChIKey: JCVLYBQFVTYGKT-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | methyl 4-octoxybenzoate |
| InChIKey | JCVLYBQFVTYGKT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)